C23H22N4O7S — CID 154748259
1-[4-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 154748259) has the molecular formula C23H22N4O7S and a molecular weight of 498.52 g/mol. Its IUPAC name is 1-[4-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 154748259 |
| Molecular Formula | C23H22N4O7S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-[4-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1COc2ccc(S(=O)(=O)N3CCN(C(=O)c4ccc(N5C(=O)CCC5=O)cc4)CC3)cc2N1 |
| InChI | InChI=1S/C23H22N4O7S/c28-20-14-34-19-6-5-17(13-18(19)24-20)35(32,33)26-11-9-25(10-12-26)23(31)15-1-3-16(4-2-15)27-21(29)7-8-22(27)30/h1-6,13H,7-12,14H2,(H,24,28) |
| InChIKey | ONSVVSCSROTZQA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|