C16H14ClN3O2 — CID 154749028
(2-chloro-4-methylphenyl) 1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylate (PubChem CID 154749028) has the molecular formula C16H14ClN3O2 and a molecular weight of 315.76 g/mol. Its IUPAC name is (2-chloro-4-methylphenyl) 1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylate.
| Compound Name | (2-chloro-4-methylphenyl) 1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 154749028 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (2-chloro-4-methylphenyl) 1,3-dimethylpyrazolo[5,4-b]pyridine-6-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2ccc3c(C)nn(C)c3n2)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClN3O2/c1-9-4-7-14(12(17)8-9)22-16(21)13-6-5-11-10(2)19-20(3)15(11)18-13/h4-8H,1-3H3 |
| InChIKey | RKUNEAKSKVVGCJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|