C20H28N4O — CID 154749153
1-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine (PubChem CID 154749153) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine.
| Compound Name | 1-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 154749153 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine |
| SMILES | Cc1cn2c(n1)C(CNCc1ccc(N3CCOCC3)cc1)CCC2 |
| InChI | InChI=1S/C20H28N4O/c1-16-15-24-8-2-3-18(20(24)22-16)14-21-13-17-4-6-19(7-5-17)23-9-11-25-12-10-23/h4-7,15,18,21H,2-3,8-14H2,1H3 |
| InChIKey | PLRCNNZKGDPCHB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|