C17H12N4O2 — CID 154749384
1'-prop-2-ynylspiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,3'-indole]-2',4-dione (PubChem CID 154749384) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1'-prop-2-ynylspiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,3'-indole]-2',4-dione.
| Compound Name | 1'-prop-2-ynylspiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 154749384 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1'-prop-2-ynylspiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,3'-indole]-2',4-dione |
| SMILES | C#CCN1C(=O)C2(NC(=O)c3cccnc3N2)c2ccccc21 |
| InChI | InChI=1S/C17H12N4O2/c1-2-10-21-13-8-4-3-7-12(13)17(16(21)23)19-14-11(15(22)20-17)6-5-9-18-14/h1,3-9H,10H2,(H,18,19)(H,20,22) |
| InChIKey | LYSKLCNHGXIWSA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|