C17H21N5O3 — CID 154749625
1-[4-[[(4-methyl-5-nitro-2-pyridinyl)amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 154749625) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[4-[[(4-methyl-5-nitro-2-pyridinyl)amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[(4-methyl-5-nitro-2-pyridinyl)amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 154749625 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[4-[[(4-methyl-5-nitro-2-pyridinyl)amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | Cc1cc(NCc2ccc(NC(=O)NC(C)C)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O3/c1-11(2)20-17(23)21-14-6-4-13(5-7-14)9-18-16-8-12(3)15(10-19-16)22(24)25/h4-8,10-11H,9H2,1-3H3,(H,18,19)(H2,20,21,23) |
| InChIKey | IULJILBJRNEIBM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|