C19H21FN2O4 — CID 154750383
N-(2-fluorophenyl)-3-[3-[2-(furan-2-yl)-2-oxoethyl]morpholin-4-yl]propanamide (PubChem CID 154750383) has the molecular formula C19H21FN2O4 and a molecular weight of 360.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[3-[2-(furan-2-yl)-2-oxoethyl]morpholin-4-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[3-[2-(furan-2-yl)-2-oxoethyl]morpholin-4-yl]propanamide |
|---|---|
| PubChem CID | 154750383 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(2-fluorophenyl)-3-[3-[2-(furan-2-yl)-2-oxoethyl]morpholin-4-yl]propanamide |
| SMILES | O=C(CCN1CCOCC1CC(=O)c1ccco1)Nc1ccccc1F |
| InChI | InChI=1S/C19H21FN2O4/c20-15-4-1-2-5-16(15)21-19(24)7-8-22-9-11-25-13-14(22)12-17(23)18-6-3-10-26-18/h1-6,10,14H,7-9,11-13H2,(H,21,24) |
| InChIKey | NVYFAXZCNSREMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |