C21H30N4 — CID 154750461
1-cyclopentyl-N-[1-(3-imidazol-1-ylphenyl)ethyl]piperidin-4-amine (PubChem CID 154750461) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-cyclopentyl-N-[1-(3-imidazol-1-ylphenyl)ethyl]piperidin-4-amine.
| Compound Name | 1-cyclopentyl-N-[1-(3-imidazol-1-ylphenyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 154750461 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-cyclopentyl-N-[1-(3-imidazol-1-ylphenyl)ethyl]piperidin-4-amine |
| SMILES | CC(NC1CCN(C2CCCC2)CC1)c1cccc(-n2ccnc2)c1 |
| InChI | InChI=1S/C21H30N4/c1-17(18-5-4-8-21(15-18)25-14-11-22-16-25)23-19-9-12-24(13-10-19)20-6-2-3-7-20/h4-5,8,11,14-17,19-20,23H,2-3,6-7,9-10,12-13H2,1H3 |
| InChIKey | ZLCSWUKWEUJSHC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |