C22H12N4O2S4 — CID 15475068
5,13-diphenyl-4,14-bis(sulfanylidene)-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),11(16)-triene-6,12-dione (PubChem CID 15475068) has the molecular formula C22H12N4O2S4 and a molecular weight of 492.63 g/mol. Its IUPAC name is 5,13-diphenyl-4,14-bis(sulfanylidene)-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),11(16)-triene-6,12-dione.
| Compound Name | 5,13-diphenyl-4,14-bis(sulfanylidene)-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),11(16)-triene-6,12-dione |
|---|---|
| PubChem CID | 15475068 |
| Molecular Formula | C22H12N4O2S4 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 5,13-diphenyl-4,14-bis(sulfanylidene)-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),11(16)-triene-6,12-dione |
| SMILES | O=c1c2sc3sc4c(=O)n(-c5ccccc5)c(=S)[nH]c4c3c2[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C22H12N4O2S4/c27-18-16-14(23-21(29)25(18)11-7-3-1-4-8-11)13-15-17(32-20(13)31-16)19(28)26(22(30)24-15)12-9-5-2-6-10-12/h1-10H,(H,23,29)(H,24,30) |
| InChIKey | DNPSUISCUCBUIK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|