About 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine
4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine (PubChem CID 154751583) has the molecular formula C17H25N5O
and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine |
| PubChem CID | 154751583 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine |
| SMILES | c1cn2c(CN3CCCCC3CN3CCOCC3)cnc2cn1 |
| InChI | InChI=1S/C17H25N5O/c1-2-5-21(15(3-1)13-20-7-9-23-10-8-20)14-16-11-19-17-12-18-4-6-22(16)17/h4,6,11-12,15H,1-3,5,7-10,13-14H2 |
| InChIKey | DQDBCJUPPORNGS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine?
The IUPAC name of 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine (CID 154751583) is 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine is c1cn2c(CN3CCCCC3CN3CCOCC3)cnc2cn1.
What is the InChIKey of 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine?
The InChIKey is DQDBCJUPPORNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O/c1-2-5-21(15(3-1)13-20-7-9-23-10-8-20)14-16-11-19-17-12-18-4-6-22(16)17/h4,6,11-12,15H,1-3,5,7-10,13-14H2.
What are the key properties of 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine?
4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine has a molecular weight of 315.42 g/mol, XLogP of 1.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(imidazo[1,2-a]pyrazin-3-ylmethyl)piperidin-2-yl]methyl]morpholine is sourced from PubChem (CID 154751583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).