C21H32N2O6 — CID 154751862
1,4-dioxaspiro[4.5]decan-8-yl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 154751862) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-8-yl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | 1,4-dioxaspiro[4.5]decan-8-yl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 154751862 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-8-yl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)OC1CCC3(CC1)OCCO3)C2=O |
| InChI | InChI=1S/C21H32N2O6/c1-14-10-19(2,3)13-20(11-14)17(25)23(18(26)22-20)12-16(24)29-15-4-6-21(7-5-15)27-8-9-28-21/h14-15H,4-13H2,1-3H3,(H,22,26) |
| InChIKey | XUXGDHRHLPFCGP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|