About methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate
methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate (PubChem CID 154752489) has the molecular formula C12H11ClF2N2O3
and a molecular weight of 304.68 g/mol. Its IUPAC name is methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate |
| PubChem CID | 154752489 |
| Molecular Formula | C12H11ClF2N2O3 |
| Molecular Weight | 304.68 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)Nc2c(F)cc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C12H11ClF2N2O3/c1-20-10(18)12(2-3-12)17-11(19)16-9-7(13)4-6(14)5-8(9)15/h4-5H,2-3H2,1H3,(H2,16,17,19) |
| InChIKey | SVAGDYGHAKGCNA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate (CID 154752489) is methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate is COC(=O)C1(NC(=O)Nc2c(F)cc(F)cc2Cl)CC1.
What is the InChIKey of methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate?
The InChIKey is SVAGDYGHAKGCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2N2O3/c1-20-10(18)12(2-3-12)17-11(19)16-9-7(13)4-6(14)5-8(9)15/h4-5H,2-3H2,1H3,(H2,16,17,19).
What are the key properties of methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate?
methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate has a molecular weight of 304.68 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2-chloro-4,6-difluorophenyl)carbamoylamino]cyclopropane-1-carboxylate is sourced from PubChem (CID 154752489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).