C15H18N2O2S2 — CID 154752601
3,4-dimethyl-N-(1-oxothian-4-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 154752601) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3,4-dimethyl-N-(1-oxothian-4-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,4-dimethyl-N-(1-oxothian-4-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154752601 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3,4-dimethyl-N-(1-oxothian-4-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccnc2sc(C(=O)NC3CCS(=O)CC3)c(C)c12 |
| InChI | InChI=1S/C15H18N2O2S2/c1-9-3-6-16-15-12(9)10(2)13(20-15)14(18)17-11-4-7-21(19)8-5-11/h3,6,11H,4-5,7-8H2,1-2H3,(H,17,18) |
| InChIKey | IKXCNUNOMGNSER-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |