C20H32N2O2 — CID 154753115
1-[4-[[1-(2-hydroxyphenyl)propylamino]methyl]piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 154753115) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-[4-[[1-(2-hydroxyphenyl)propylamino]methyl]piperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[[1-(2-hydroxyphenyl)propylamino]methyl]piperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 154753115 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-[4-[[1-(2-hydroxyphenyl)propylamino]methyl]piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CCC(NCC1CCN(C(=O)C(C)(C)C)CC1)c1ccccc1O |
| InChI | InChI=1S/C20H32N2O2/c1-5-17(16-8-6-7-9-18(16)23)21-14-15-10-12-22(13-11-15)19(24)20(2,3)4/h6-9,15,17,21,23H,5,10-14H2,1-4H3 |
| InChIKey | CLMVLGZDDLGBNS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|