C14H22O2 — CID 15475314
(3S,3aE,6S,9S,9aR)-3-hydroxy-3,6,9-trimethyl-2,6,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-5-one (PubChem CID 15475314) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3S,3aE,6S,9S,9aR)-3-hydroxy-3,6,9-trimethyl-2,6,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-5-one.
| Compound Name | (3S,3aE,6S,9S,9aR)-3-hydroxy-3,6,9-trimethyl-2,6,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-5-one |
|---|---|
| PubChem CID | 15475314 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3S,3aE,6S,9S,9aR)-3-hydroxy-3,6,9-trimethyl-2,6,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-5-one |
| SMILES | C[C@H]1CC[C@H](C)[C@H]2CC[C@](C)(O)/C2=C/C1=O |
| InChI | InChI=1S/C14H22O2/c1-9-4-5-10(2)13(15)8-12-11(9)6-7-14(12,3)16/h8-11,16H,4-7H2,1-3H3/b12-8+/t9-,10-,11+,14-/m0/s1 |
| InChIKey | RUGUESBOXSHDTF-GJXCQEEASA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |