About 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide
2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 154753375) has the molecular formula C16H17FN4O3S
and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide |
| PubChem CID | 154753375 |
| Molecular Formula | C16H17FN4O3S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | CCn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2ccc(F)cc2C#N)cn1 |
| InChI | InChI=1S/C16H17FN4O3S/c1-2-21-10-12(9-19-21)16-14(5-6-24-16)20-25(22,23)15-4-3-13(17)7-11(15)8-18/h3-4,7,9-10,14,16,20H,2,5-6H2,1H3/t14-,16+/m0/s1 |
| InChIKey | LVGAJVSJCUZXCH-GOEBONIOSA-N |
| XLogP | 1.72 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide?
The IUPAC name of 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide (CID 154753375) is 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide?
The canonical SMILES for 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide is CCn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2ccc(F)cc2C#N)cn1.
What is the InChIKey of 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide?
The InChIKey is LVGAJVSJCUZXCH-GOEBONIOSA-N. The full InChI is InChI=1S/C16H17FN4O3S/c1-2-21-10-12(9-19-21)16-14(5-6-24-16)20-25(22,23)15-4-3-13(17)7-11(15)8-18/h3-4,7,9-10,14,16,20H,2,5-6H2,1H3/t14-,16+/m0/s1.
What are the key properties of 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide?
2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide has a molecular weight of 364.40 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 154753375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).