C18H18N2O2S — CID 154753594
2-[(2S,3S)-2-phenyloxolan-3-yl]-5-(1-thiophen-3-ylethyl)-1,3,4-oxadiazole (PubChem CID 154753594) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[(2S,3S)-2-phenyloxolan-3-yl]-5-(1-thiophen-3-ylethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(2S,3S)-2-phenyloxolan-3-yl]-5-(1-thiophen-3-ylethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 154753594 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[(2S,3S)-2-phenyloxolan-3-yl]-5-(1-thiophen-3-ylethyl)-1,3,4-oxadiazole |
| SMILES | CC(c1ccsc1)c1nnc([C@H]2CCO[C@@H]2c2ccccc2)o1 |
| InChI | InChI=1S/C18H18N2O2S/c1-12(14-8-10-23-11-14)17-19-20-18(22-17)15-7-9-21-16(15)13-5-3-2-4-6-13/h2-6,8,10-12,15-16H,7,9H2,1H3/t12?,15-,16+/m0/s1 |
| InChIKey | USTPKIORYNJYKB-FFPFEORLSA-N |
| XLogP | 4.53 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |