C14H21FN6OS — CID 154753863
3-[[[(2S,4S)-4-fluoro-1-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methyl-methylamino]methyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 154753863) has the molecular formula C14H21FN6OS and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[[[(2S,4S)-4-fluoro-1-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methyl-methylamino]methyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[[[(2S,4S)-4-fluoro-1-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methyl-methylamino]methyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 154753863 |
| Molecular Formula | C14H21FN6OS |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[[[(2S,4S)-4-fluoro-1-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methyl-methylamino]methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | Cc1ncsc1CN1C[C@@H](F)C[C@H]1CN(C)Cc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C14H21FN6OS/c1-9-12(23-8-16-9)6-21-4-10(15)3-11(21)5-20(2)7-13-17-14(22)19-18-13/h8,10-11H,3-7H2,1-2H3,(H2,17,18,19,22)/t10-,11-/m0/s1 |
| InChIKey | KJCKDVYTWQIJME-QWRGUYRKSA-N |
| XLogP | 0.91 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |