About [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol
[1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol (PubChem CID 154754185) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol |
| PubChem CID | 154754185 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol |
| SMILES | OCc1cn([C@@H]2CCCC[C@@H]2NCc2coc3ccccc23)nn1 |
| InChI | InChI=1S/C18H22N4O2/c23-11-14-10-22(21-20-14)17-7-3-2-6-16(17)19-9-13-12-24-18-8-4-1-5-15(13)18/h1,4-5,8,10,12,16-17,19,23H,2-3,6-7,9,11H2/t16-,17+/m0/s1 |
| InChIKey | OPYPAXDIIXBOOD-DLBZAZTESA-N |
| XLogP | 2.79 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol?
The IUPAC name of [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol (CID 154754185) is [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol is OCc1cn([C@@H]2CCCC[C@@H]2NCc2coc3ccccc23)nn1.
What is the InChIKey of [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol?
The InChIKey is OPYPAXDIIXBOOD-DLBZAZTESA-N. The full InChI is InChI=1S/C18H22N4O2/c23-11-14-10-22(21-20-14)17-7-3-2-6-16(17)19-9-13-12-24-18-8-4-1-5-15(13)18/h1,4-5,8,10,12,16-17,19,23H,2-3,6-7,9,11H2/t16-,17+/m0/s1.
What are the key properties of [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol?
[1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol has a molecular weight of 326.40 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1R,2S)-2-(1-benzofuran-3-ylmethylamino)cyclohexyl]triazol-4-yl]methanol is sourced from PubChem (CID 154754185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).