About 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol
2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol (PubChem CID 154754187) has the molecular formula C16H26N6O
and a molecular weight of 318.43 g/mol. Its IUPAC name is 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol |
| PubChem CID | 154754187 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol |
| SMILES | Cn1cncc1CN[C@H]1CCCC[C@H]1n1cc(C(C)(C)O)nn1 |
| InChI | InChI=1S/C16H26N6O/c1-16(2,23)15-10-22(20-19-15)14-7-5-4-6-13(14)18-9-12-8-17-11-21(12)3/h8,10-11,13-14,18,23H,4-7,9H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | ATHCSSHWUUOTFG-UONOGXRCSA-N |
| XLogP | 1.51 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
The IUPAC name of 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol (CID 154754187) is 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol.
What is the SMILES notation for 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
The canonical SMILES for 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol is Cn1cncc1CN[C@H]1CCCC[C@H]1n1cc(C(C)(C)O)nn1.
What is the InChIKey of 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
The InChIKey is ATHCSSHWUUOTFG-UONOGXRCSA-N. The full InChI is InChI=1S/C16H26N6O/c1-16(2,23)15-10-22(20-19-15)14-7-5-4-6-13(14)18-9-12-8-17-11-21(12)3/h8,10-11,13-14,18,23H,4-7,9H2,1-3H3/t13-,14+/m0/s1.
What are the key properties of 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol has a molecular weight of 318.43 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1R,2S)-2-[(3-methylimidazol-4-yl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol is sourced from PubChem (CID 154754187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).