C15H21F2N3O2 — CID 154754246
[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl] 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate (PubChem CID 154754246) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is [(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl] 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate.
| Compound Name | [(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl] 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154754246 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl] 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate |
| SMILES | O=C(O[C@H]1CCN(CC(F)F)C1)c1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C15H21F2N3O2/c16-13(17)9-20-7-6-10(8-20)22-15(21)14-11-4-2-1-3-5-12(11)18-19-14/h10,13H,1-9H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | AMPIMXJVSCLFSA-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |