C20H20N4O2 — CID 154754431
2-[2-(3-indazol-2-ylpyrrolidin-1-yl)-2-oxoethyl]benzamide (PubChem CID 154754431) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-[2-(3-indazol-2-ylpyrrolidin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | 2-[2-(3-indazol-2-ylpyrrolidin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 154754431 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[2-(3-indazol-2-ylpyrrolidin-1-yl)-2-oxoethyl]benzamide |
| SMILES | NC(=O)c1ccccc1CC(=O)N1CCC(n2cc3ccccc3n2)C1 |
| InChI | InChI=1S/C20H20N4O2/c21-20(26)17-7-3-1-5-14(17)11-19(25)23-10-9-16(13-23)24-12-15-6-2-4-8-18(15)22-24/h1-8,12,16H,9-11,13H2,(H2,21,26) |
| InChIKey | ONGLKHDQUBBCNM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |