C19H27N5O2S — CID 154754463
5-(acetamidomethyl)-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 154754463) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 5-(acetamidomethyl)-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 5-(acetamidomethyl)-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154754463 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 5-(acetamidomethyl)-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(=O)NCC1CCn2ncc(C(=O)NCc3nc(C(C)(C)C)cs3)c2C1 |
| InChI | InChI=1S/C19H27N5O2S/c1-12(25)20-8-13-5-6-24-15(7-13)14(9-22-24)18(26)21-10-17-23-16(11-27-17)19(2,3)4/h9,11,13H,5-8,10H2,1-4H3,(H,20,25)(H,21,26) |
| InChIKey | UFZPYLGIFYJNAJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |