About [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol
[1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol (PubChem CID 154754611) has the molecular formula C13H13F3N8O
and a molecular weight of 354.30 g/mol. Its IUPAC name is [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol |
| PubChem CID | 154754611 |
| Molecular Formula | C13H13F3N8O |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2ccc(NCc3nnnn3CC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C13H13F3N8O/c14-13(15,16)8-24-12(19-20-22-24)5-17-9-1-3-11(4-2-9)23-6-10(7-25)18-21-23/h1-4,6,17,25H,5,7-8H2 |
| InChIKey | OTOLMCRVYDXQJO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol?
The IUPAC name of [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol (CID 154754611) is [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol is OCc1cn(-c2ccc(NCc3nnnn3CC(F)(F)F)cc2)nn1.
What is the InChIKey of [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol?
The InChIKey is OTOLMCRVYDXQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N8O/c14-13(15,16)8-24-12(19-20-22-24)5-17-9-1-3-11(4-2-9)23-6-10(7-25)18-21-23/h1-4,6,17,25H,5,7-8H2.
What are the key properties of [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol?
[1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol has a molecular weight of 354.30 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methylamino]phenyl]triazol-4-yl]methanol is sourced from PubChem (CID 154754611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).