C16H22N4O2 — CID 154754645
7-[2-[(dimethylamino)methyl]benzoyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 154754645) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 7-[2-[(dimethylamino)methyl]benzoyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[2-[(dimethylamino)methyl]benzoyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 154754645 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 7-[2-[(dimethylamino)methyl]benzoyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CN(C)Cc1ccccc1C(=O)N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C16H22N4O2/c1-18(2)10-12-5-3-4-6-14(12)15(21)19-7-8-20-13(11-19)9-17-16(20)22/h3-6,13H,7-11H2,1-2H3,(H,17,22) |
| InChIKey | JLMHREXFGLINLK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |