C16H18FN3O — CID 154754896
1-[(1-ethenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)pyrrolidin-3-ol (PubChem CID 154754896) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-[(1-ethenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)pyrrolidin-3-ol.
| Compound Name | 1-[(1-ethenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 154754896 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(1-ethenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)pyrrolidin-3-ol |
| SMILES | C=Cn1cc(CN2CCC(O)(c3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C16H18FN3O/c1-2-20-11-13(9-18-20)10-19-8-7-16(21,12-19)14-3-5-15(17)6-4-14/h2-6,9,11,21H,1,7-8,10,12H2 |
| InChIKey | RIZJMNLNOFPAAX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |