C17H18N2O3 — CID 154755476
3-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]isochromen-1-one (PubChem CID 154755476) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]isochromen-1-one.
| Compound Name | 3-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]isochromen-1-one |
|---|---|
| PubChem CID | 154755476 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]isochromen-1-one |
| SMILES | CN1C[C@@H]2CN(C(=O)c3cc4ccccc4c(=O)o3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H18N2O3/c1-18-7-12-9-19(10-13(12)8-18)16(20)15-6-11-4-2-3-5-14(11)17(21)22-15/h2-6,12-13H,7-10H2,1H3/t12-,13+ |
| InChIKey | XKBAWGCKIPUMOM-BETUJISGSA-N |
| XLogP | 1.43 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |