About 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol
3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol (PubChem CID 154755579) has the molecular formula C16H20N2O2S
and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol.
Molecular Properties
| Compound Name | 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol |
| PubChem CID | 154755579 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol |
| SMILES | OC1CCOCC1C1CCCN1c1ccnc2ccsc12 |
| InChI | InChI=1S/C16H20N2O2S/c19-15-4-8-20-10-11(15)13-2-1-7-18(13)14-3-6-17-12-5-9-21-16(12)14/h3,5-6,9,11,13,15,19H,1-2,4,7-8,10H2 |
| InChIKey | ZBOIZEJLSLOITC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol?
The IUPAC name of 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol (CID 154755579) is 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol.
What is the SMILES notation for 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol?
The canonical SMILES for 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol is OC1CCOCC1C1CCCN1c1ccnc2ccsc12.
What is the InChIKey of 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol?
The InChIKey is ZBOIZEJLSLOITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S/c19-15-4-8-20-10-11(15)13-2-1-7-18(13)14-3-6-17-12-5-9-21-16(12)14/h3,5-6,9,11,13,15,19H,1-2,4,7-8,10H2.
What are the key properties of 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol?
3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol has a molecular weight of 304.41 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-2-yl)oxan-4-ol is sourced from PubChem (CID 154755579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).