About 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one
2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one (PubChem CID 154755788) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one |
| PubChem CID | 154755788 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one |
| SMILES | COC1Cc2ccccc2N(C(=O)Cn2ncc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C20H19N3O3/c1-26-16-10-14-6-3-5-9-18(14)22(12-16)19(24)13-23-20(25)17-8-4-2-7-15(17)11-21-23/h2-9,11,16H,10,12-13H2,1H3 |
| InChIKey | OSHNITMQZLMQIV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one?
The IUPAC name of 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one (CID 154755788) is 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one.
What is the SMILES notation for 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one?
The canonical SMILES for 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one is COC1Cc2ccccc2N(C(=O)Cn2ncc3ccccc3c2=O)C1.
What is the InChIKey of 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one?
The InChIKey is OSHNITMQZLMQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3/c1-26-16-10-14-6-3-5-9-18(14)22(12-16)19(24)13-23-20(25)17-8-4-2-7-15(17)11-21-23/h2-9,11,16H,10,12-13H2,1H3.
What are the key properties of 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one?
2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one has a molecular weight of 349.39 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phthalazin-1-one is sourced from PubChem (CID 154755788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).