About 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol
1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol (PubChem CID 154756863) has the molecular formula C17H23N7O
and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol.
Molecular Properties
| Compound Name | 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
| PubChem CID | 154756863 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
| SMILES | CC(C)n1cc(C2(O)CCCN(Cc3cn4cccnc4n3)C2)nn1 |
| InChI | InChI=1S/C17H23N7O/c1-13(2)24-11-15(20-21-24)17(25)5-3-7-22(12-17)9-14-10-23-8-4-6-18-16(23)19-14/h4,6,8,10-11,13,25H,3,5,7,9,12H2,1-2H3 |
| InChIKey | PQLTWJCVKKGFAI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol?
The IUPAC name of 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol (CID 154756863) is 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol.
What is the SMILES notation for 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol?
The canonical SMILES for 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol is CC(C)n1cc(C2(O)CCCN(Cc3cn4cccnc4n3)C2)nn1.
What is the InChIKey of 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol?
The InChIKey is PQLTWJCVKKGFAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N7O/c1-13(2)24-11-15(20-21-24)17(25)5-3-7-22(12-17)9-14-10-23-8-4-6-18-16(23)19-14/h4,6,8,10-11,13,25H,3,5,7,9,12H2,1-2H3.
What are the key properties of 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol?
1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol has a molecular weight of 341.42 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol is sourced from PubChem (CID 154756863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).