C11H22N6O2S — CID 154757462
N-[2-[1-(1-methyltetrazol-5-yl)ethylamino]cyclohexyl]methanesulfonamide (PubChem CID 154757462) has the molecular formula C11H22N6O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[2-[1-(1-methyltetrazol-5-yl)ethylamino]cyclohexyl]methanesulfonamide.
| Compound Name | N-[2-[1-(1-methyltetrazol-5-yl)ethylamino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 154757462 |
| Molecular Formula | C11H22N6O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[2-[1-(1-methyltetrazol-5-yl)ethylamino]cyclohexyl]methanesulfonamide |
| SMILES | CC(NC1CCCCC1NS(C)(=O)=O)c1nnnn1C |
| InChI | InChI=1S/C11H22N6O2S/c1-8(11-13-15-16-17(11)2)12-9-6-4-5-7-10(9)14-20(3,18)19/h8-10,12,14H,4-7H2,1-3H3 |
| InChIKey | NDNGYRNIWZODNH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |