About 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide
6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide (PubChem CID 154757700) has the molecular formula C17H22N4O4S
and a molecular weight of 378.45 g/mol. Its IUPAC name is 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide |
| PubChem CID | 154757700 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide |
| SMILES | COc1cc(OC)cc(N2CCC(Nc3ccc(S(N)(=O)=O)cn3)C2)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-24-14-7-13(8-15(9-14)25-2)21-6-5-12(11-21)20-17-4-3-16(10-19-17)26(18,22)23/h3-4,7-10,12H,5-6,11H2,1-2H3,(H,19,20)(H2,18,22,23) |
| InChIKey | GNMYGSAMNXXVGY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide?
The IUPAC name of 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide (CID 154757700) is 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide.
What is the SMILES notation for 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide?
The canonical SMILES for 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide is COc1cc(OC)cc(N2CCC(Nc3ccc(S(N)(=O)=O)cn3)C2)c1.
What is the InChIKey of 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide?
The InChIKey is GNMYGSAMNXXVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O4S/c1-24-14-7-13(8-15(9-14)25-2)21-6-5-12(11-21)20-17-4-3-16(10-19-17)26(18,22)23/h3-4,7-10,12H,5-6,11H2,1-2H3,(H,19,20)(H2,18,22,23).
What are the key properties of 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide?
6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide has a molecular weight of 378.45 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide is sourced from PubChem (CID 154757700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).