About 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide
4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide (PubChem CID 154757906) has the molecular formula C16H29F2N3O2
and a molecular weight of 333.42 g/mol. Its IUPAC name is 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide.
Molecular Properties
| Compound Name | 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide |
| PubChem CID | 154757906 |
| Molecular Formula | C16H29F2N3O2 |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide |
| SMILES | CCCCN1CCOCC1C(=O)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C16H29F2N3O2/c1-2-3-6-21-9-10-23-12-14(21)16(22)19-13-4-7-20(8-5-13)11-15(17)18/h13-15H,2-12H2,1H3,(H,19,22) |
| InChIKey | QZKHBLCZJFBGOS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide?
The IUPAC name of 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide (CID 154757906) is 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide.
What is the SMILES notation for 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide?
The canonical SMILES for 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide is CCCCN1CCOCC1C(=O)NC1CCN(CC(F)F)CC1.
What is the InChIKey of 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide?
The InChIKey is QZKHBLCZJFBGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29F2N3O2/c1-2-3-6-21-9-10-23-12-14(21)16(22)19-13-4-7-20(8-5-13)11-15(17)18/h13-15H,2-12H2,1H3,(H,19,22).
What are the key properties of 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide?
4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide has a molecular weight of 333.42 g/mol, XLogP of 1.33, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-N-[1-(2,2-difluoroethyl)piperidin-4-yl]morpholine-3-carboxamide is sourced from PubChem (CID 154757906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).