C15H17N3O3S — CID 154758220
N-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4,6,7,8-tetrahydrofuro[3,2-c]azepine-5-carboxamide (PubChem CID 154758220) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4,6,7,8-tetrahydrofuro[3,2-c]azepine-5-carboxamide.
| Compound Name | N-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4,6,7,8-tetrahydrofuro[3,2-c]azepine-5-carboxamide |
|---|---|
| PubChem CID | 154758220 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4,6,7,8-tetrahydrofuro[3,2-c]azepine-5-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)COCC2)N1CCCc2occc2C1 |
| InChI | InChI=1S/C15H17N3O3S/c19-15(17-14-16-11-4-6-20-9-13(11)22-14)18-5-1-2-12-10(8-18)3-7-21-12/h3,7H,1-2,4-6,8-9H2,(H,16,17,19) |
| InChIKey | LJXZCVZFJIODNF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |