C13H18N2O4S — CID 154758302
N-[(3S,4R)-4-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide (PubChem CID 154758302) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-[(3S,4R)-4-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide.
| Compound Name | N-[(3S,4R)-4-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 154758302 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[(3S,4R)-4-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| SMILES | C[C@H]1CS(=O)(=O)C[C@H]1NC(=O)c1noc2c1CCCC2 |
| InChI | InChI=1S/C13H18N2O4S/c1-8-6-20(17,18)7-10(8)14-13(16)12-9-4-2-3-5-11(9)19-15-12/h8,10H,2-7H2,1H3,(H,14,16)/t8-,10+/m0/s1 |
| InChIKey | WFUCSKCWLVURIZ-WCBMZHEXSA-N |
| XLogP | 0.72 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |