C17H21F3N2O2 — CID 154759205
[5-amino-2-(trifluoromethyl)piperidin-1-yl]-[4-(cyclopropylmethoxy)phenyl]methanone (PubChem CID 154759205) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is [5-amino-2-(trifluoromethyl)piperidin-1-yl]-[4-(cyclopropylmethoxy)phenyl]methanone.
| Compound Name | [5-amino-2-(trifluoromethyl)piperidin-1-yl]-[4-(cyclopropylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 154759205 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [5-amino-2-(trifluoromethyl)piperidin-1-yl]-[4-(cyclopropylmethoxy)phenyl]methanone |
| SMILES | NC1CCC(C(F)(F)F)N(C(=O)c2ccc(OCC3CC3)cc2)C1 |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)15-8-5-13(21)9-22(15)16(23)12-3-6-14(7-4-12)24-10-11-1-2-11/h3-4,6-7,11,13,15H,1-2,5,8-10,21H2 |
| InChIKey | GQBVYJKTZIRFIO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |