About N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide
N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide (PubChem CID 154759422) has the molecular formula C15H10F3N5OS
and a molecular weight of 365.34 g/mol. Its IUPAC name is N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide |
| PubChem CID | 154759422 |
| Molecular Formula | C15H10F3N5OS |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1nnc(-c2ccccc2)s1)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C15H10F3N5OS/c16-15(17,18)10-7-4-8-19-11(10)12(24)20-22-14-23-21-13(25-14)9-5-2-1-3-6-9/h1-8H,(H,20,24)(H,22,23) |
| InChIKey | OKJIHNFOWFTXMT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide?
The IUPAC name of N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide (CID 154759422) is N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide.
What is the SMILES notation for N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide?
The canonical SMILES for N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide is O=C(NNc1nnc(-c2ccccc2)s1)c1ncccc1C(F)(F)F.
What is the InChIKey of N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide?
The InChIKey is OKJIHNFOWFTXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N5OS/c16-15(17,18)10-7-4-8-19-11(10)12(24)20-22-14-23-21-13(25-14)9-5-2-1-3-6-9/h1-8H,(H,20,24)(H,22,23).
What are the key properties of N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide?
N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide has a molecular weight of 365.34 g/mol, XLogP of 3.38, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)pyridine-2-carbohydrazide is sourced from PubChem (CID 154759422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).