About 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one
2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one (PubChem CID 154760682) has the molecular formula C11H14F2N2O
and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one |
| PubChem CID | 154760682 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one |
| SMILES | O=c1cccnn1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H14F2N2O/c12-11(13)5-3-9(4-6-11)8-15-10(16)2-1-7-14-15/h1-2,7,9H,3-6,8H2 |
| InChIKey | PQNDLLDNZHALFH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one?
The IUPAC name of 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one (CID 154760682) is 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one.
What is the SMILES notation for 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one?
The canonical SMILES for 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one is O=c1cccnn1CC1CCC(F)(F)CC1.
What is the InChIKey of 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one?
The InChIKey is PQNDLLDNZHALFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2O/c12-11(13)5-3-9(4-6-11)8-15-10(16)2-1-7-14-15/h1-2,7,9H,3-6,8H2.
What are the key properties of 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one?
2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one has a molecular weight of 228.24 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-difluorocyclohexyl)methyl]pyridazin-3-one is sourced from PubChem (CID 154760682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).