About N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine
N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine (PubChem CID 154761137) has the molecular formula C14H18FN5O
and a molecular weight of 291.33 g/mol. Its IUPAC name is N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine |
| PubChem CID | 154761137 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine |
| SMILES | CCn1ccnc1[C@@H]1OCC[C@H]1CNc1ncc(F)cn1 |
| InChI | InChI=1S/C14H18FN5O/c1-2-20-5-4-16-13(20)12-10(3-6-21-12)7-17-14-18-8-11(15)9-19-14/h4-5,8-10,12H,2-3,6-7H2,1H3,(H,17,18,19)/t10-,12+/m0/s1 |
| InChIKey | IKGQUNUEBDSTPR-CMPLNLGQSA-N |
| XLogP | 2.02 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine?
The IUPAC name of N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine (CID 154761137) is N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine.
What is the SMILES notation for N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine?
The canonical SMILES for N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine is CCn1ccnc1[C@@H]1OCC[C@H]1CNc1ncc(F)cn1.
What is the InChIKey of N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine?
The InChIKey is IKGQUNUEBDSTPR-CMPLNLGQSA-N. The full InChI is InChI=1S/C14H18FN5O/c1-2-20-5-4-16-13(20)12-10(3-6-21-12)7-17-14-18-8-11(15)9-19-14/h4-5,8-10,12H,2-3,6-7H2,1H3,(H,17,18,19)/t10-,12+/m0/s1.
What are the key properties of N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine?
N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine has a molecular weight of 291.33 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]methyl]-5-fluoropyrimidin-2-amine is sourced from PubChem (CID 154761137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).