C18H26N4O3 — CID 154761375
6-(2-methoxyethoxy)-N-[[(2R,3S)-2-(1-methylimidazol-2-yl)oxan-3-yl]methyl]pyridin-3-amine (PubChem CID 154761375) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N-[[(2R,3S)-2-(1-methylimidazol-2-yl)oxan-3-yl]methyl]pyridin-3-amine.
| Compound Name | 6-(2-methoxyethoxy)-N-[[(2R,3S)-2-(1-methylimidazol-2-yl)oxan-3-yl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 154761375 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 6-(2-methoxyethoxy)-N-[[(2R,3S)-2-(1-methylimidazol-2-yl)oxan-3-yl]methyl]pyridin-3-amine |
| SMILES | COCCOc1ccc(NC[C@@H]2CCCO[C@H]2c2nccn2C)cn1 |
| InChI | InChI=1S/C18H26N4O3/c1-22-8-7-19-18(22)17-14(4-3-9-25-17)12-20-15-5-6-16(21-13-15)24-11-10-23-2/h5-8,13-14,17,20H,3-4,9-12H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | WGIBKYLAHXCKGR-WMLDXEAASA-N |
| XLogP | 2.42 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|