C17H24N4O — CID 154761377
N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]-2-(3-methyl-4-pyridinyl)ethanamine (PubChem CID 154761377) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]-2-(3-methyl-4-pyridinyl)ethanamine.
| Compound Name | N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]-2-(3-methyl-4-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 154761377 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]-2-(3-methyl-4-pyridinyl)ethanamine |
| SMILES | Cc1cnccc1CCNC[C@H]1CCO[C@@H]1c1cnn(C)c1 |
| InChI | InChI=1S/C17H24N4O/c1-13-9-18-6-3-14(13)4-7-19-10-15-5-8-22-17(15)16-11-20-21(2)12-16/h3,6,9,11-12,15,17,19H,4-5,7-8,10H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | XPXMBOLLNLSRPE-WBVHZDCISA-N |
| XLogP | 2.03 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|