About 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile
4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile (PubChem CID 154761477) has the molecular formula C19H19N5O
and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile |
| PubChem CID | 154761477 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccccc2c1NC[C@@H]1CCCO[C@H]1c1cn[nH]c1 |
| InChI | InChI=1S/C19H19N5O/c20-8-14-10-21-17-6-2-1-5-16(17)18(14)22-9-13-4-3-7-25-19(13)15-11-23-24-12-15/h1-2,5-6,10-13,19H,3-4,7,9H2,(H,21,22)(H,23,24)/t13-,19+/m0/s1 |
| InChIKey | DZPZLWDGIWJPIE-ORAYPTAESA-N |
| XLogP | 3.41 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile?
The IUPAC name of 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile (CID 154761477) is 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile.
What is the SMILES notation for 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile?
The canonical SMILES for 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile is N#Cc1cnc2ccccc2c1NC[C@@H]1CCCO[C@H]1c1cn[nH]c1.
What is the InChIKey of 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile?
The InChIKey is DZPZLWDGIWJPIE-ORAYPTAESA-N. The full InChI is InChI=1S/C19H19N5O/c20-8-14-10-21-17-6-2-1-5-16(17)18(14)22-9-13-4-3-7-25-19(13)15-11-23-24-12-15/h1-2,5-6,10-13,19H,3-4,7,9H2,(H,21,22)(H,23,24)/t13-,19+/m0/s1.
What are the key properties of 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile?
4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile has a molecular weight of 333.39 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R,3S)-2-(1H-pyrazol-4-yl)oxan-3-yl]methylamino]quinoline-3-carbonitrile is sourced from PubChem (CID 154761477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).