C12H20F3N5O — CID 154761740
(3R,4S)-N,N-dimethyl-4-(triazol-1-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-amine (PubChem CID 154761740) has the molecular formula C12H20F3N5O and a molecular weight of 307.32 g/mol. Its IUPAC name is (3R,4S)-N,N-dimethyl-4-(triazol-1-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-amine.
| Compound Name | (3R,4S)-N,N-dimethyl-4-(triazol-1-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 154761740 |
| Molecular Formula | C12H20F3N5O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R,4S)-N,N-dimethyl-4-(triazol-1-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-amine |
| SMILES | CN(C)[C@@H]1CN(CCOCC(F)(F)F)C[C@@H]1n1ccnn1 |
| InChI | InChI=1S/C12H20F3N5O/c1-18(2)10-7-19(5-6-21-9-12(13,14)15)8-11(10)20-4-3-16-17-20/h3-4,10-11H,5-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | GPPWQTXCRZNGRS-MNOVXSKESA-N |
| XLogP | 0.64 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|