About 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile
4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile (PubChem CID 154761869) has the molecular formula C15H15BrN4O
and a molecular weight of 347.22 g/mol. Its IUPAC name is 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile |
| PubChem CID | 154761869 |
| Molecular Formula | C15H15BrN4O |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Br)c(CN[C@H]2CCO[C@@H]2c2ccn[nH]2)c1 |
| InChI | InChI=1S/C15H15BrN4O/c16-12-2-1-10(8-17)7-11(12)9-18-13-4-6-21-15(13)14-3-5-19-20-14/h1-3,5,7,13,15,18H,4,6,9H2,(H,19,20)/t13-,15-/m0/s1 |
| InChIKey | WMNGUZMBFBHNAT-ZFWWWQNUSA-N |
| XLogP | 2.66 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile?
The IUPAC name of 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile (CID 154761869) is 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile.
What is the SMILES notation for 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile?
The canonical SMILES for 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile is N#Cc1ccc(Br)c(CN[C@H]2CCO[C@@H]2c2ccn[nH]2)c1.
What is the InChIKey of 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile?
The InChIKey is WMNGUZMBFBHNAT-ZFWWWQNUSA-N. The full InChI is InChI=1S/C15H15BrN4O/c16-12-2-1-10(8-17)7-11(12)9-18-13-4-6-21-15(13)14-3-5-19-20-14/h1-3,5,7,13,15,18H,4,6,9H2,(H,19,20)/t13-,15-/m0/s1.
What are the key properties of 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile?
4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile has a molecular weight of 347.22 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[[[(2S,3S)-2-(1H-pyrazol-5-yl)oxolan-3-yl]amino]methyl]benzonitrile is sourced from PubChem (CID 154761869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).