C13H20F3N5O2 — CID 154762369
N-(2-methoxyethyl)-3,7-dimethyl-N-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 154762369) has the molecular formula C13H20F3N5O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,7-dimethyl-N-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3,7-dimethyl-N-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 154762369 |
| Molecular Formula | C13H20F3N5O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(2-methoxyethyl)-3,7-dimethyl-N-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | COCCN(CC(F)(F)F)C(=O)C1Cn2c(C)nnc2CN1C |
| InChI | InChI=1S/C13H20F3N5O2/c1-9-17-18-11-7-19(2)10(6-21(9)11)12(22)20(4-5-23-3)8-13(14,15)16/h10H,4-8H2,1-3H3 |
| InChIKey | KTVJPZIMUDRVEP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |