C15H19F2NO3 — CID 154762450
[3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-(4-methoxy-3-propan-2-ylphenyl)methanone (PubChem CID 154762450) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is [3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-(4-methoxy-3-propan-2-ylphenyl)methanone.
| Compound Name | [3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-(4-methoxy-3-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 154762450 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-(4-methoxy-3-propan-2-ylphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CC(O)(C(F)F)C2)cc1C(C)C |
| InChI | InChI=1S/C15H19F2NO3/c1-9(2)11-6-10(4-5-12(11)21-3)13(19)18-7-15(20,8-18)14(16)17/h4-6,9,14,20H,7-8H2,1-3H3 |
| InChIKey | GIJSPCMHXJDKDK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |