About [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate
[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate (PubChem CID 15476399) has the molecular formula C9H8F3NO3S
and a molecular weight of 267.23 g/mol. Its IUPAC name is [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate.
Molecular Properties
| Compound Name | [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate |
| PubChem CID | 15476399 |
| Molecular Formula | C9H8F3NO3S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate |
| SMILES | CS(=O)(=O)O/N=C(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO3S/c1-17(14,15)16-13-8(9(10,11)12)7-5-3-2-4-6-7/h2-6H,1H3/b13-8- |
| InChIKey | XWZJATUDGDKYGK-JYRVWZFOSA-N |
| XLogP | 1.93 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate?
The IUPAC name of [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate (CID 15476399) is [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate.
What is the SMILES notation for [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate?
The canonical SMILES for [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate is CS(=O)(=O)O/N=C(/c1ccccc1)C(F)(F)F.
What is the InChIKey of [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate?
The InChIKey is XWZJATUDGDKYGK-JYRVWZFOSA-N. The full InChI is InChI=1S/C9H8F3NO3S/c1-17(14,15)16-13-8(9(10,11)12)7-5-3-2-4-6-7/h2-6H,1H3/b13-8-.
What are the key properties of [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate?
[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate has a molecular weight of 267.23 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] methanesulfonate is sourced from PubChem (CID 15476399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).