About 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide
2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide (PubChem CID 154764341) has the molecular formula C19H19F2NO2
and a molecular weight of 331.36 g/mol. Its IUPAC name is 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide |
| PubChem CID | 154764341 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide |
| SMILES | O=C(CC12CCCCC1C2(F)F)Nc1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C19H19F2NO2/c20-19(21)16-7-3-4-10-18(16,19)11-17(24)22-14-8-9-15(23)13-6-2-1-5-12(13)14/h1-2,5-6,8-9,16,23H,3-4,7,10-11H2,(H,22,24) |
| InChIKey | ZQODKKXTWCCXOR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide?
The IUPAC name of 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide (CID 154764341) is 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide.
What is the SMILES notation for 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide?
The canonical SMILES for 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide is O=C(CC12CCCCC1C2(F)F)Nc1ccc(O)c2ccccc12.
What is the InChIKey of 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide?
The InChIKey is ZQODKKXTWCCXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2NO2/c20-19(21)16-7-3-4-10-18(16,19)11-17(24)22-14-8-9-15(23)13-6-2-1-5-12(13)14/h1-2,5-6,8-9,16,23H,3-4,7,10-11H2,(H,22,24).
What are the key properties of 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide?
2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide has a molecular weight of 331.36 g/mol, XLogP of 4.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,7-difluoro-1-bicyclo[4.1.0]heptanyl)-N-(4-hydroxynaphthalen-1-yl)acetamide is sourced from PubChem (CID 154764341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).