About 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide
2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide (PubChem CID 154764633) has the molecular formula C14H18FNO2S
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide |
| PubChem CID | 154764633 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1CN1CCc2cccc(F)c2C1 |
| InChI | InChI=1S/C14H18FNO2S/c15-14-5-1-3-11-6-7-16(10-13(11)14)9-12-4-2-8-19(12,17)18/h1,3,5,12H,2,4,6-10H2 |
| InChIKey | PJNSJWWCLWVWIV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide?
The IUPAC name of 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide (CID 154764633) is 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide.
What is the SMILES notation for 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide?
The canonical SMILES for 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide is O=S1(=O)CCCC1CN1CCc2cccc(F)c2C1.
What is the InChIKey of 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide?
The InChIKey is PJNSJWWCLWVWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2S/c15-14-5-1-3-11-6-7-16(10-13(11)14)9-12-4-2-8-19(12,17)18/h1,3,5,12H,2,4,6-10H2.
What are the key properties of 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide?
2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide has a molecular weight of 283.37 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]thiolane 1,1-dioxide is sourced from PubChem (CID 154764633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).