About tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate
tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate (PubChem CID 154764666) has the molecular formula C16H29FN4O2
and a molecular weight of 328.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate |
| PubChem CID | 154764666 |
| Molecular Formula | C16H29FN4O2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate |
| SMILES | Cc1c(CC(CNCCF)CNC(=O)OC(C)(C)C)cnn1C |
| InChI | InChI=1S/C16H29FN4O2/c1-12-14(11-20-21(12)5)8-13(9-18-7-6-17)10-19-15(22)23-16(2,3)4/h11,13,18H,6-10H2,1-5H3,(H,19,22) |
| InChIKey | PTLYWFBLCVCMLT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate (CID 154764666) is tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate is Cc1c(CC(CNCCF)CNC(=O)OC(C)(C)C)cnn1C.
What is the InChIKey of tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate?
The InChIKey is PTLYWFBLCVCMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29FN4O2/c1-12-14(11-20-21(12)5)8-13(9-18-7-6-17)10-19-15(22)23-16(2,3)4/h11,13,18H,6-10H2,1-5H3,(H,19,22).
What are the key properties of tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate?
tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate has a molecular weight of 328.43 g/mol, XLogP of 1.97, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-fluoroethylamino)propyl]carbamate is sourced from PubChem (CID 154764666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).