C12H17FN4O — CID 154764943
3-(5-fluoro-2-pyridinyl)-1-methyl-1-(1-methylpyrrolidin-3-yl)urea (PubChem CID 154764943) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-(5-fluoro-2-pyridinyl)-1-methyl-1-(1-methylpyrrolidin-3-yl)urea.
| Compound Name | 3-(5-fluoro-2-pyridinyl)-1-methyl-1-(1-methylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 154764943 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-(5-fluoro-2-pyridinyl)-1-methyl-1-(1-methylpyrrolidin-3-yl)urea |
| SMILES | CN1CCC(N(C)C(=O)Nc2ccc(F)cn2)C1 |
| InChI | InChI=1S/C12H17FN4O/c1-16-6-5-10(8-16)17(2)12(18)15-11-4-3-9(13)7-14-11/h3-4,7,10H,5-6,8H2,1-2H3,(H,14,15,18) |
| InChIKey | SRBBHSJNAFYZFD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |